C25H21ClF3NO4 — CID 24950433
2-[4-[(E)-C-[(4-chlorophenyl)methyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetic acid (PubChem CID 24950433) has the molecular formula C25H21ClF3NO4 and a molecular weight of 491.89 g/mol. Its IUPAC name is 2-[4-[(E)-C-[(4-chlorophenyl)methyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-C-[(4-chlorophenyl)methyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 24950433 |
| Molecular Formula | C25H21ClF3NO4 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[4-[(E)-C-[(4-chlorophenyl)methyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(/C(Cc2ccc(Cl)cc2)=N/OCc2ccc(C(F)(F)F)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C25H21ClF3NO4/c1-16-12-19(6-11-23(16)33-15-24(31)32)22(13-17-4-9-21(26)10-5-17)30-34-14-18-2-7-20(8-3-18)25(27,28)29/h2-12H,13-15H2,1H3,(H,31,32)/b30-22+ |
| InChIKey | MZYVITRFJMWGNP-JBASAIQMSA-N |
| XLogP | 6.29 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|