C26H30F3NO4 — CID 24949129
ethyl 2-[4-[(E)-C-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate (PubChem CID 24949129) has the molecular formula C26H30F3NO4 and a molecular weight of 477.52 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-C-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-C-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 24949129 |
| Molecular Formula | C26H30F3NO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | ethyl 2-[4-[(E)-C-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C(=N/OCc2ccc(C(F)(F)F)cc2)C2CCCCC2)cc1C |
| InChI | InChI=1S/C26H30F3NO4/c1-3-32-24(31)17-33-23-14-11-21(15-18(23)2)25(20-7-5-4-6-8-20)30-34-16-19-9-12-22(13-10-19)26(27,28)29/h9-15,20H,3-8,16-17H2,1-2H3/b30-25+ |
| InChIKey | QNNZHOZXCYKOPN-QCWLDUFUSA-N |
| XLogP | 6.46 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|