C29H31F3N2O4S — CID 173469237
2-[2-methyl-4-[2-thiophen-3-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 173469237) has the molecular formula C29H31F3N2O4S and a molecular weight of 560.64 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-thiophen-3-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[2-methyl-4-[2-thiophen-3-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 173469237 |
| Molecular Formula | C29H31F3N2O4S |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 2-[2-methyl-4-[2-thiophen-3-yl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | Cc1cc(CC(=NOCc2ccc(C(F)(F)F)cc2)c2ccsc2)ccc1OCC(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C29H31F3N2O4S/c1-20-14-23(4-7-27(20)37-18-28(35)33-16-21-8-11-36-12-9-21)15-26(24-10-13-39-19-24)34-38-17-22-2-5-25(6-3-22)29(30,31)32/h2-7,10,13-14,19,21H,8-9,11-12,15-18H2,1H3,(H,33,35) |
| InChIKey | GICPFCFPBUAZHW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|