C29H31F3N4O3 — CID 57415598
3-[5-[(E)-C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide (PubChem CID 57415598) has the molecular formula C29H31F3N4O3 and a molecular weight of 540.59 g/mol. Its IUPAC name is 3-[5-[(E)-C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide.
| Compound Name | 3-[5-[(E)-C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 57415598 |
| Molecular Formula | C29H31F3N4O3 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-[5-[(E)-C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide |
| SMILES | O=C(CCc1ncc(/C(Cc2ccccc2)=N/OCc2ccc(C(F)(F)F)cc2)cn1)NCC1CCOCC1 |
| InChI | InChI=1S/C29H31F3N4O3/c30-29(31,32)25-8-6-23(7-9-25)20-39-36-26(16-21-4-2-1-3-5-21)24-18-33-27(34-19-24)10-11-28(37)35-17-22-12-14-38-15-13-22/h1-9,18-19,22H,10-17,20H2,(H,35,37)/b36-26+ |
| InChIKey | IMBFNSKOIIJNRA-LZBRRTOVSA-N |
| XLogP | 5.13 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|