C29H30F3N3O4 — CID 76528867
2-[[5-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 76528867) has the molecular formula C29H30F3N3O4 and a molecular weight of 541.57 g/mol. Its IUPAC name is 2-[[5-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[[5-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 76528867 |
| Molecular Formula | C29H30F3N3O4 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 2-[[5-[C-benzyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(C(Cc2ccccc2)=NOCc2ccc(C(F)(F)F)cc2)cn1)NCC1CCOCC1 |
| InChI | InChI=1S/C29H30F3N3O4/c30-29(31,32)25-9-6-23(7-10-25)19-39-35-26(16-21-4-2-1-3-5-21)24-8-11-28(34-18-24)38-20-27(36)33-17-22-12-14-37-15-13-22/h1-11,18,22H,12-17,19-20H2,(H,33,36) |
| InChIKey | LALBYOJKYMEDSF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|