C23H28FN3O4 — CID 57414736
2-[[5-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 57414736) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[[5-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[[5-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 57414736 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[[5-[(E)-C-ethyl-N-[(4-fluorophenyl)methoxy]carbonimidoyl]-2-pyridinyl]oxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | CC/C(=N\OCc1ccc(F)cc1)c1ccc(OCC(=O)NCC2CCOCC2)nc1 |
| InChI | InChI=1S/C23H28FN3O4/c1-2-21(27-31-15-18-3-6-20(24)7-4-18)19-5-8-23(26-14-19)30-16-22(28)25-13-17-9-11-29-12-10-17/h3-8,14,17H,2,9-13,15-16H2,1H3,(H,25,28)/b27-21+ |
| InChIKey | IITXIXNOEWNWIJ-SZXQPVLSSA-N |
| XLogP | 3.47 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|