C25H29F3N2O4 — CID 57414079
2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 57414079) has the molecular formula C25H29F3N2O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 57414079 |
| Molecular Formula | C25H29F3N2O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-[4-[(E)-C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | CC/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(OCC(=O)NCC2CCOCC2)cc1 |
| InChI | InChI=1S/C25H29F3N2O4/c1-2-23(30-34-16-19-3-7-21(8-4-19)25(26,27)28)20-5-9-22(10-6-20)33-17-24(31)29-15-18-11-13-32-14-12-18/h3-10,18H,2,11-17H2,1H3,(H,29,31)/b30-23+ |
| InChIKey | KPEKJKCHHZFETH-JJKYIXSRSA-N |
| XLogP | 4.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|