C24H29F3N4O3 — CID 76528916
3-[5-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide (PubChem CID 76528916) has the molecular formula C24H29F3N4O3 and a molecular weight of 478.52 g/mol. Its IUPAC name is 3-[5-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide.
| Compound Name | 3-[5-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 76528916 |
| Molecular Formula | C24H29F3N4O3 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 3-[5-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]pyrimidin-2-yl]-N-(oxan-4-ylmethyl)propanamide |
| SMILES | CCC(=NOCc1ccc(C(F)(F)F)cc1)c1cnc(CCC(=O)NCC2CCOCC2)nc1 |
| InChI | InChI=1S/C24H29F3N4O3/c1-2-21(31-34-16-18-3-5-20(6-4-18)24(25,26)27)19-14-28-22(29-15-19)7-8-23(32)30-13-17-9-11-33-12-10-17/h3-6,14-15,17H,2,7-13,16H2,1H3,(H,30,32) |
| InChIKey | FLXMLISMCUFXNO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|