C26H30F3NO4 — CID 173144476
2-[4-[2-cyclopentyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-methylphenoxy]butanoic acid (PubChem CID 173144476) has the molecular formula C26H30F3NO4 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[4-[2-cyclopentyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-methylphenoxy]butanoic acid.
| Compound Name | 2-[4-[2-cyclopentyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 173144476 |
| Molecular Formula | C26H30F3NO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[4-[2-cyclopentyl-2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]-2-methylphenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CC(=NOCc2ccc(C(F)(F)F)cc2)C2CCCC2)cc1C)C(=O)O |
| InChI | InChI=1S/C26H30F3NO4/c1-3-23(25(31)32)34-24-13-10-19(14-17(24)2)15-22(20-6-4-5-7-20)30-33-16-18-8-11-21(12-9-18)26(27,28)29/h8-14,20,23H,3-7,15-16H2,1-2H3,(H,31,32) |
| InChIKey | JURPGBGKEKAIOD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|