C15H20F3NO — CID 145436363
2,4-dimethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]pentan-3-imine (PubChem CID 145436363) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 2,4-dimethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]pentan-3-imine.
| Compound Name | 2,4-dimethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]pentan-3-imine |
|---|---|
| PubChem CID | 145436363 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2,4-dimethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]pentan-3-imine |
| SMILES | CC(C)C(=NOCc1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H20F3NO/c1-10(2)14(11(3)4)19-20-9-12-5-7-13(8-6-12)15(16,17)18/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | LKRRPCNWESFHOW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|