C18H18F3NO — CID 22968889
(E)-1-(3-ethylphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 22968889) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (E)-1-(3-ethylphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-1-(3-ethylphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 22968889 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (E)-1-(3-ethylphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | CCc1cccc(/C(C)=N/OCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H18F3NO/c1-3-14-5-4-6-16(11-14)13(2)22-23-12-15-7-9-17(10-8-15)18(19,20)21/h4-11H,3,12H2,1-2H3/b22-13+ |
| InChIKey | IQHWBOTYDWLVRX-LPYMAVHISA-N |
| XLogP | 5.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|