C19H16F3NO2 — CID 118954273
(E)-1-(4-prop-2-ynoxyphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 118954273) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is (E)-1-(4-prop-2-ynoxyphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-1-(4-prop-2-ynoxyphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 118954273 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (E)-1-(4-prop-2-ynoxyphenyl)-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | C#CCOc1ccc(/C(C)=N/OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H16F3NO2/c1-3-12-24-18-10-6-16(7-11-18)14(2)23-25-13-15-4-8-17(9-5-15)19(20,21)22/h1,4-11H,12-13H2,2H3/b23-14+ |
| InChIKey | XWQKDVGKCYGWRN-OEAKJJBVSA-N |
| XLogP | 4.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|