C21H22F3NO3 — CID 123786679
3-methyl-1-[4-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butan-2-one (PubChem CID 123786679) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-methyl-1-[4-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butan-2-one.
| Compound Name | 3-methyl-1-[4-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butan-2-one |
|---|---|
| PubChem CID | 123786679 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-methyl-1-[4-[C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butan-2-one |
| SMILES | CC(=NOCc1ccc(C(F)(F)F)cc1)c1ccc(OCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C21H22F3NO3/c1-14(2)20(26)13-27-19-10-6-17(7-11-19)15(3)25-28-12-16-4-8-18(9-5-16)21(22,23)24/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | QRTQIZWBHGTCAQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|