C39H32F3N3O2 — CID 118954283
(E)-N-[[4-(trifluoromethyl)phenyl]methoxy]-1-[4-[(1-tritylimidazol-4-yl)methoxy]phenyl]ethanimine (PubChem CID 118954283) has the molecular formula C39H32F3N3O2 and a molecular weight of 631.70 g/mol. Its IUPAC name is (E)-N-[[4-(trifluoromethyl)phenyl]methoxy]-1-[4-[(1-tritylimidazol-4-yl)methoxy]phenyl]ethanimine.
| Compound Name | (E)-N-[[4-(trifluoromethyl)phenyl]methoxy]-1-[4-[(1-tritylimidazol-4-yl)methoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 118954283 |
| Molecular Formula | C39H32F3N3O2 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | (E)-N-[[4-(trifluoromethyl)phenyl]methoxy]-1-[4-[(1-tritylimidazol-4-yl)methoxy]phenyl]ethanimine |
| SMILES | C/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(OCc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C39H32F3N3O2/c1-29(44-47-26-30-17-21-35(22-18-30)39(40,41)42)31-19-23-37(24-20-31)46-27-36-25-45(28-43-36)38(32-11-5-2-6-12-32,33-13-7-3-8-14-33)34-15-9-4-10-16-34/h2-25,28H,26-27H2,1H3/b44-29+ |
| InChIKey | KUTDNZLMAAGWTP-MHIAAIFOSA-N |
| XLogP | 9.26 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|