C24H20F3NO3 — CID 59219227
2-[3-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]phenyl]acetic acid (PubChem CID 59219227) has the molecular formula C24H20F3NO3 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[3-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59219227 |
| Molecular Formula | C24H20F3NO3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[3-[4-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]phenyl]acetic acid |
| SMILES | C/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(-c2cccc(CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H20F3NO3/c1-16(28-31-15-17-5-11-22(12-6-17)24(25,26)27)19-7-9-20(10-8-19)21-4-2-3-18(13-21)14-23(29)30/h2-13H,14-15H2,1H3,(H,29,30)/b28-16+ |
| InChIKey | SHGRCQQOBHHFBU-LQKURTRISA-N |
| XLogP | 5.94 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|