C16H10F6O2 — CID 118342919
2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetic acid (PubChem CID 118342919) has the molecular formula C16H10F6O2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 118342919 |
| Molecular Formula | C16H10F6O2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H10F6O2/c17-15(18,19)12-6-11(7-13(8-12)16(20,21)22)10-3-1-2-9(4-10)5-14(23)24/h1-4,6-8H,5H2,(H,23,24) |
| InChIKey | ITNMVGIYOZPEGD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |