C15H11F3O2S — CID 91875732
2-[3-[4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid (PubChem CID 91875732) has the molecular formula C15H11F3O2S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-[3-[4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[3-[4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 91875732 |
| Molecular Formula | C15H11F3O2S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[3-[4-(trifluoromethyl)phenyl]sulfanylphenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(Sc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H11F3O2S/c16-15(17,18)11-4-6-12(7-5-11)21-13-3-1-2-10(8-13)9-14(19)20/h1-8H,9H2,(H,19,20) |
| InChIKey | HWLIPQBNJCLOIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |