About phenylsulfanylbenzene;trifluoromethylbenzene
phenylsulfanylbenzene;trifluoromethylbenzene (PubChem CID 171924180) has the molecular formula C19H15F3S
and a molecular weight of 332.39 g/mol. Its IUPAC name is phenylsulfanylbenzene;trifluoromethylbenzene.
Molecular Properties
| Compound Name | phenylsulfanylbenzene;trifluoromethylbenzene |
| PubChem CID | 171924180 |
| Molecular Formula | C19H15F3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | phenylsulfanylbenzene;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C7H5F3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9,10)6-4-2-1-3-5-6/h1-10H;1-5H |
| InChIKey | MPLUVYKODQGHEU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenylsulfanylbenzene;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylbenzene;trifluoromethylbenzene?
The IUPAC name of phenylsulfanylbenzene;trifluoromethylbenzene (CID 171924180) is phenylsulfanylbenzene;trifluoromethylbenzene.
What is the SMILES notation for phenylsulfanylbenzene;trifluoromethylbenzene?
The canonical SMILES for phenylsulfanylbenzene;trifluoromethylbenzene is FC(F)(F)c1ccccc1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of phenylsulfanylbenzene;trifluoromethylbenzene?
The InChIKey is MPLUVYKODQGHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C7H5F3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9,10)6-4-2-1-3-5-6/h1-10H;1-5H.
What are the key properties of phenylsulfanylbenzene;trifluoromethylbenzene?
phenylsulfanylbenzene;trifluoromethylbenzene has a molecular weight of 332.39 g/mol, XLogP of 6.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylbenzene;trifluoromethylbenzene is sourced from PubChem (CID 171924180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).