About CID 66690055
CID 66690055 (PubChem CID 66690055) has the molecular formula C12H10Na2S
and a molecular weight of 232.26 g/mol.
Molecular Properties
| Compound Name | CID 66690055 |
| PubChem CID | 66690055 |
| Molecular Formula | C12H10Na2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | — |
| SMILES | [Na].[Na].c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.2Na/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;; |
| InChIKey | GEDFVWZEMJCEEQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 66690055 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66690055?
The IUPAC name of CID 66690055 (CID 66690055) is not available.
What is the SMILES notation for CID 66690055?
The canonical SMILES for CID 66690055 is [Na].[Na].c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of CID 66690055?
The InChIKey is GEDFVWZEMJCEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.2Na/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1-10H;;.
What are the key properties of CID 66690055?
CID 66690055 has a molecular weight of 232.26 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66690055 is sourced from PubChem (CID 66690055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).