About methoxymethane;phenylsulfanylbenzene
methoxymethane;phenylsulfanylbenzene (PubChem CID 175087336) has the molecular formula C14H16OS
and a molecular weight of 232.35 g/mol. Its IUPAC name is methoxymethane;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | methoxymethane;phenylsulfanylbenzene |
| PubChem CID | 175087336 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | methoxymethane;phenylsulfanylbenzene |
| SMILES | COC.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C2H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10H;1-2H3 |
| InChIKey | VKRVJWVSVYMZLZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxymethane;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;phenylsulfanylbenzene?
The IUPAC name of methoxymethane;phenylsulfanylbenzene (CID 175087336) is methoxymethane;phenylsulfanylbenzene.
What is the SMILES notation for methoxymethane;phenylsulfanylbenzene?
The canonical SMILES for methoxymethane;phenylsulfanylbenzene is COC.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of methoxymethane;phenylsulfanylbenzene?
The InChIKey is VKRVJWVSVYMZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C2H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10H;1-2H3.
What are the key properties of methoxymethane;phenylsulfanylbenzene?
methoxymethane;phenylsulfanylbenzene has a molecular weight of 232.35 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;phenylsulfanylbenzene is sourced from PubChem (CID 175087336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).