C21H24S2 — CID 158378208
1,4-bis(phenylsulfanyl)benzene;ethane;tritiomethane (PubChem CID 158378208) has the molecular formula C21H24S2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 1,4-bis(phenylsulfanyl)benzene;ethane;tritiomethane.
| Compound Name | 1,4-bis(phenylsulfanyl)benzene;ethane;tritiomethane |
|---|---|
| PubChem CID | 158378208 |
| Molecular Formula | C21H24S2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1,4-bis(phenylsulfanyl)benzene;ethane;tritiomethane |
| SMILES | CC.[3H]C.c1ccc(Sc2ccc(Sc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14S2.C2H6.CH4/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16;1-2;/h1-14H;1-2H3;1H4/i;;1T |
| InChIKey | GVLRSIBFXBCMIK-ZDNREJLISA-N |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |