About ethanethiol;phenylsulfanylbenzene
ethanethiol;phenylsulfanylbenzene (PubChem CID 174826904) has the molecular formula C14H16S2
and a molecular weight of 248.42 g/mol. Its IUPAC name is ethanethiol;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | ethanethiol;phenylsulfanylbenzene |
| PubChem CID | 174826904 |
| Molecular Formula | C14H16S2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | ethanethiol;phenylsulfanylbenzene |
| SMILES | CCS.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C2H6S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10H;3H,2H2,1H3 |
| InChIKey | AZGFQMQOYYTNJQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethiol;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethiol;phenylsulfanylbenzene?
The IUPAC name of ethanethiol;phenylsulfanylbenzene (CID 174826904) is ethanethiol;phenylsulfanylbenzene.
What is the SMILES notation for ethanethiol;phenylsulfanylbenzene?
The canonical SMILES for ethanethiol;phenylsulfanylbenzene is CCS.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of ethanethiol;phenylsulfanylbenzene?
The InChIKey is AZGFQMQOYYTNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C2H6S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10H;3H,2H2,1H3.
What are the key properties of ethanethiol;phenylsulfanylbenzene?
ethanethiol;phenylsulfanylbenzene has a molecular weight of 248.42 g/mol, XLogP of 4.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethiol;phenylsulfanylbenzene is sourced from PubChem (CID 174826904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).