About acetonitrile;phenylsulfanylbenzene
acetonitrile;phenylsulfanylbenzene (PubChem CID 175483964) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is acetonitrile;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | acetonitrile;phenylsulfanylbenzene |
| PubChem CID | 175483964 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | acetonitrile;phenylsulfanylbenzene |
| SMILES | CC#N.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C2H3N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10H;1H3 |
| InChIKey | JFPRKOSSVATBKM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;phenylsulfanylbenzene?
The IUPAC name of acetonitrile;phenylsulfanylbenzene (CID 175483964) is acetonitrile;phenylsulfanylbenzene.
What is the SMILES notation for acetonitrile;phenylsulfanylbenzene?
The canonical SMILES for acetonitrile;phenylsulfanylbenzene is CC#N.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of acetonitrile;phenylsulfanylbenzene?
The InChIKey is JFPRKOSSVATBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C2H3N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3/h1-10H;1H3.
What are the key properties of acetonitrile;phenylsulfanylbenzene?
acetonitrile;phenylsulfanylbenzene has a molecular weight of 227.33 g/mol, XLogP of 4.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;phenylsulfanylbenzene is sourced from PubChem (CID 175483964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).