About bis(acetonitrile);1,1'-biphenyl
bis(acetonitrile);1,1'-biphenyl (PubChem CID 175366291) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is bis(acetonitrile);1,1'-biphenyl.
Molecular Properties
| Compound Name | bis(acetonitrile);1,1'-biphenyl |
| PubChem CID | 175366291 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | bis(acetonitrile);1,1'-biphenyl |
| SMILES | CC#N.CC#N.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C2H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2-3/h1-10H;2*1H3 |
| InChIKey | FXVFQHTWNOLPIY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(acetonitrile);1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);1,1'-biphenyl?
The IUPAC name of bis(acetonitrile);1,1'-biphenyl (CID 175366291) is bis(acetonitrile);1,1'-biphenyl.
What is the SMILES notation for bis(acetonitrile);1,1'-biphenyl?
The canonical SMILES for bis(acetonitrile);1,1'-biphenyl is CC#N.CC#N.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(acetonitrile);1,1'-biphenyl?
The InChIKey is FXVFQHTWNOLPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.2C2H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2-3/h1-10H;2*1H3.
What are the key properties of bis(acetonitrile);1,1'-biphenyl?
bis(acetonitrile);1,1'-biphenyl has a molecular weight of 236.32 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);1,1'-biphenyl is sourced from PubChem (CID 175366291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).