About acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene
acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 22320800) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene.
Analyze acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene?
The IUPAC name of acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene (CID 22320800) is acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene.
What is the SMILES notation for acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene?
The canonical SMILES for acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene is CC#N.c1cc2cc-2c1.
What is the InChIKey of acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene?
The InChIKey is NSDPURKNLQPCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C2H3N/c1-2-5-4-6(5)3-1;1-2-3/h1-4H;1H3.
What are the key properties of acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene?
acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene has a molecular weight of 117.15 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;bicyclo[3.1.0]hexa-1(6),2,4-triene is sourced from PubChem (CID 22320800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).