C23H30 — CID 171489435
1,3-diphenylbenzene;ethane;methane (PubChem CID 171489435) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1,3-diphenylbenzene;ethane;methane.
| Compound Name | 1,3-diphenylbenzene;ethane;methane |
|---|---|
| PubChem CID | 171489435 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1,3-diphenylbenzene;ethane;methane |
| SMILES | C.CC.CC.c1ccc(-c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C18H14.2C2H6.CH4/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;2*1-2;/h1-14H;2*1-2H3;1H4 |
| InChIKey | JYHJXFORRGUPHF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |