C78H54 — CID 166563615
1,3-bis(3,5-diphenylphenyl)-5-[4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]phenyl]benzene (PubChem CID 166563615) has the molecular formula C78H54 and a molecular weight of 991.29 g/mol. Its IUPAC name is 1,3-bis(3,5-diphenylphenyl)-5-[4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]phenyl]benzene.
| Compound Name | 1,3-bis(3,5-diphenylphenyl)-5-[4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 166563615 |
| Molecular Formula | C78H54 |
| Molecular Weight | 991.29 g/mol |
| Exact Mass | 990.42 |
| IUPAC Name | 1,3-bis(3,5-diphenylphenyl)-5-[4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]phenyl]benzene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cccc(-c5ccc(-c6cc(-c7cc(-c8ccccc8)cc(-c8ccccc8)c7)cc(-c7cc(-c8ccccc8)cc(-c8ccccc8)c7)c6)cc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C78H54/c1-7-21-55(22-8-1)67-43-68(56-23-9-2-10-24-56)47-74(46-67)66-36-20-35-65(42-66)64-34-19-33-63(41-64)61-37-39-62(40-38-61)73-52-77(75-48-69(57-25-11-3-12-26-57)44-70(49-75)58-27-13-4-14-28-58)54-78(53-73)76-50-71(59-29-15-5-16-30-59)45-72(51-76)60-31-17-6-18-32-60/h1-54H |
| InChIKey | IXFNSVSJKXAUOY-UHFFFAOYSA-N |
| XLogP | 21.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.29 |
| LogP ≤ 5 | 21.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |