C60H40 — CID 177480216
4,9,14,19,24-pentakis-phenylhexacyclo[20.3.1.12,6.17,11.112,16.117,21]triaconta-1(26),2(30),3,5,7(29),8,10,12(28),13,15,17,19,21(27),22,24-pentadecaene (PubChem CID 177480216) has the molecular formula C60H40 and a molecular weight of 760.98 g/mol. Its IUPAC name is 4,9,14,19,24-pentakis-phenylhexacyclo[20.3.1.12,6.17,11.112,16.117,21]triaconta-1(26),2(30),3,5,7(29),8,10,12(28),13,15,17,19,21(27),22,24-pentadecaene.
| Compound Name | 4,9,14,19,24-pentakis-phenylhexacyclo[20.3.1.12,6.17,11.112,16.117,21]triaconta-1(26),2(30),3,5,7(29),8,10,12(28),13,15,17,19,21(27),22,24-pentadecaene |
|---|---|
| PubChem CID | 177480216 |
| Molecular Formula | C60H40 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.31 |
| IUPAC Name | 4,9,14,19,24-pentakis-phenylhexacyclo[20.3.1.12,6.17,11.112,16.117,21]triaconta-1(26),2(30),3,5,7(29),8,10,12(28),13,15,17,19,21(27),22,24-pentadecaene |
| SMILES | c1ccc(-c2cc3cc(c2)-c2cc(-c4ccccc4)cc(c2)-c2cc(-c4ccccc4)cc(c2)-c2cc(-c4ccccc4)cc(c2)-c2cc(-c4ccccc4)cc-3c2)cc1 |
| InChI | InChI=1S/C60H40/c1-6-16-41(17-7-1)46-26-51-36-52(27-46)54-29-48(43-20-10-3-11-21-43)31-56(38-54)58-33-50(45-24-14-5-15-25-45)35-60(40-58)59-34-49(44-22-12-4-13-23-44)32-57(39-59)55-30-47(28-53(51)37-55)42-18-8-2-9-19-42/h1-40H |
| InChIKey | GHIUDGLLVHGDET-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |