C54H38 — CID 177124488
1-(3-phenylphenyl)-3,5-bis[3-(3-phenylphenyl)phenyl]benzene (PubChem CID 177124488) has the molecular formula C54H38 and a molecular weight of 686.90 g/mol. Its IUPAC name is 1-(3-phenylphenyl)-3,5-bis[3-(3-phenylphenyl)phenyl]benzene.
| Compound Name | 1-(3-phenylphenyl)-3,5-bis[3-(3-phenylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 177124488 |
| Molecular Formula | C54H38 |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | 1-(3-phenylphenyl)-3,5-bis[3-(3-phenylphenyl)phenyl]benzene |
| SMILES | c1ccc(-c2cccc(-c3cccc(-c4cc(-c5cccc(-c6ccccc6)c5)cc(-c5cccc(-c6cccc(-c7ccccc7)c6)c5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C54H38/c1-4-15-39(16-5-1)42-21-10-24-45(31-42)47-26-13-29-50(34-47)53-36-52(49-28-12-23-44(33-49)41-19-8-3-9-20-41)37-54(38-53)51-30-14-27-48(35-51)46-25-11-22-43(32-46)40-17-6-2-7-18-40/h1-38H |
| InChIKey | YTLDYUDDPLZHPD-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |