C48H42 — CID 140841473
1,3,5-tris[3-(3,5-dimethylphenyl)phenyl]benzene (PubChem CID 140841473) has the molecular formula C48H42 and a molecular weight of 618.86 g/mol. Its IUPAC name is 1,3,5-tris[3-(3,5-dimethylphenyl)phenyl]benzene.
| Compound Name | 1,3,5-tris[3-(3,5-dimethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 140841473 |
| Molecular Formula | C48H42 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 1,3,5-tris[3-(3,5-dimethylphenyl)phenyl]benzene |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3cc(-c4cccc(-c5cc(C)cc(C)c5)c4)cc(-c4cccc(-c5cc(C)cc(C)c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C48H42/c1-31-16-32(2)20-43(19-31)37-10-7-13-40(25-37)46-28-47(41-14-8-11-38(26-41)44-21-33(3)17-34(4)22-44)30-48(29-46)42-15-9-12-39(27-42)45-23-35(5)18-36(6)24-45/h7-30H,1-6H3 |
| InChIKey | JAZKHQHHDJCISH-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |