C40H34 — CID 59552818
1,4-bis[3-(3,5-dimethylphenyl)phenyl]-2-phenylbenzene (PubChem CID 59552818) has the molecular formula C40H34 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1,4-bis[3-(3,5-dimethylphenyl)phenyl]-2-phenylbenzene.
| Compound Name | 1,4-bis[3-(3,5-dimethylphenyl)phenyl]-2-phenylbenzene |
|---|---|
| PubChem CID | 59552818 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1,4-bis[3-(3,5-dimethylphenyl)phenyl]-2-phenylbenzene |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3ccc(-c4cccc(-c5cc(C)cc(C)c5)c4)c(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C40H34/c1-27-18-28(2)21-37(20-27)33-13-8-12-32(24-33)35-16-17-39(40(26-35)31-10-6-5-7-11-31)36-15-9-14-34(25-36)38-22-29(3)19-30(4)23-38/h5-26H,1-4H3 |
| InChIKey | PJDZFBKXICUSLP-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |