C20H20S — CID 174481520
1,3-dimethyl-5-(3-phenylphenyl)benzene;sulfane (PubChem CID 174481520) has the molecular formula C20H20S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-phenylphenyl)benzene;sulfane.
| Compound Name | 1,3-dimethyl-5-(3-phenylphenyl)benzene;sulfane |
|---|---|
| PubChem CID | 174481520 |
| Molecular Formula | C20H20S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,3-dimethyl-5-(3-phenylphenyl)benzene;sulfane |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3ccccc3)c2)c1.S |
| InChI | InChI=1S/C20H18.H2S/c1-15-11-16(2)13-20(12-15)19-10-6-9-18(14-19)17-7-4-3-5-8-17;/h3-14H,1-2H3;1H2 |
| InChIKey | GYGYAJHWGIXCHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |