C33H28 — CID 59552733
1-methyl-3,5-bis[3-(4-methylphenyl)phenyl]benzene (PubChem CID 59552733) has the molecular formula C33H28 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-methyl-3,5-bis[3-(4-methylphenyl)phenyl]benzene.
| Compound Name | 1-methyl-3,5-bis[3-(4-methylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 59552733 |
| Molecular Formula | C33H28 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-methyl-3,5-bis[3-(4-methylphenyl)phenyl]benzene |
| SMILES | Cc1ccc(-c2cccc(-c3cc(C)cc(-c4cccc(-c5ccc(C)cc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C33H28/c1-23-10-14-26(15-11-23)28-6-4-8-30(20-28)32-18-25(3)19-33(22-32)31-9-5-7-29(21-31)27-16-12-24(2)13-17-27/h4-22H,1-3H3 |
| InChIKey | DJOUDBJCUNVZDS-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |