C34H30 — CID 58892382
1-[4-[3,5-bis(4-methylphenyl)phenyl]phenyl]-3,5-dimethylbenzene (PubChem CID 58892382) has the molecular formula C34H30 and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-[4-[3,5-bis(4-methylphenyl)phenyl]phenyl]-3,5-dimethylbenzene.
| Compound Name | 1-[4-[3,5-bis(4-methylphenyl)phenyl]phenyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 58892382 |
| Molecular Formula | C34H30 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[4-[3,5-bis(4-methylphenyl)phenyl]phenyl]-3,5-dimethylbenzene |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)cc(-c3ccc(-c4cc(C)cc(C)c4)cc3)c2)cc1 |
| InChI | InChI=1S/C34H30/c1-23-5-9-27(10-6-23)32-20-33(28-11-7-24(2)8-12-28)22-34(21-32)30-15-13-29(14-16-30)31-18-25(3)17-26(4)19-31/h5-22H,1-4H3 |
| InChIKey | APGUDFJGYOLIQE-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |