C17H22O — CID 123650314
1,3-dimethyl-5-(4-methylphenyl)benzene;ethanol (PubChem CID 123650314) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-methylphenyl)benzene;ethanol.
| Compound Name | 1,3-dimethyl-5-(4-methylphenyl)benzene;ethanol |
|---|---|
| PubChem CID | 123650314 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1,3-dimethyl-5-(4-methylphenyl)benzene;ethanol |
| SMILES | CCO.Cc1ccc(-c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C15H16.C2H6O/c1-11-4-6-14(7-5-11)15-9-12(2)8-13(3)10-15;1-2-3/h4-10H,1-3H3;3H,2H2,1H3 |
| InChIKey | OHLKYAPNABPJNX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |