C16H16O — CID 11148810
1-[4-(3,5-dimethylphenyl)phenyl]ethanone (PubChem CID 11148810) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenyl)phenyl]ethanone.
| Compound Name | 1-[4-(3,5-dimethylphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 11148810 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-[4-(3,5-dimethylphenyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C16H16O/c1-11-8-12(2)10-16(9-11)15-6-4-14(5-7-15)13(3)17/h4-10H,1-3H3 |
| InChIKey | UBMOPBKMERPGRG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |