C38H32N2 — CID 59552735
2-[3,4-bis[3-(3,5-dimethylphenyl)phenyl]phenyl]pyrimidine (PubChem CID 59552735) has the molecular formula C38H32N2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[3,4-bis[3-(3,5-dimethylphenyl)phenyl]phenyl]pyrimidine.
| Compound Name | 2-[3,4-bis[3-(3,5-dimethylphenyl)phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 59552735 |
| Molecular Formula | C38H32N2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-[3,4-bis[3-(3,5-dimethylphenyl)phenyl]phenyl]pyrimidine |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3ccc(-c4ncccn4)cc3-c3cccc(-c4cc(C)cc(C)c4)c3)c2)c1 |
| InChI | InChI=1S/C38H32N2/c1-25-16-26(2)19-34(18-25)29-8-5-10-31(22-29)36-13-12-33(38-39-14-7-15-40-38)24-37(36)32-11-6-9-30(23-32)35-20-27(3)17-28(4)21-35/h5-24H,1-4H3 |
| InChIKey | GYXRBXBGBQHDQJ-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |