About 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine
2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine (PubChem CID 158374042) has the molecular formula C18H20N4
and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine |
| PubChem CID | 158374042 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine |
| SMILES | CC(C)C.c1cnc(-c2cccc(-c3ncccn3)c2)nc1 |
| InChI | InChI=1S/C14H10N4.C4H10/c1-4-11(13-15-6-2-7-16-13)10-12(5-1)14-17-8-3-9-18-14;1-4(2)3/h1-10H;4H,1-3H3 |
| InChIKey | GUYZUGPGDGKDDF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine?
The IUPAC name of 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine (CID 158374042) is 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine.
What is the SMILES notation for 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine?
The canonical SMILES for 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine is CC(C)C.c1cnc(-c2cccc(-c3ncccn3)c2)nc1.
What is the InChIKey of 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine?
The InChIKey is GUYZUGPGDGKDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4.C4H10/c1-4-11(13-15-6-2-7-16-13)10-12(5-1)14-17-8-3-9-18-14;1-4(2)3/h1-10H;4H,1-3H3.
What are the key properties of 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine?
2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine has a molecular weight of 292.39 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;2-(3-pyrimidin-2-ylphenyl)pyrimidine is sourced from PubChem (CID 158374042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).