C32H22N4 — CID 137433530
2-phenyl-4-(4-phenylphenyl)-6-(3-pyrimidin-2-ylphenyl)pyrimidine (PubChem CID 137433530) has the molecular formula C32H22N4 and a molecular weight of 462.56 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-(3-pyrimidin-2-ylphenyl)pyrimidine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-(3-pyrimidin-2-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 137433530 |
| Molecular Formula | C32H22N4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-(3-pyrimidin-2-ylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cccc(-c5ncccn5)c4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C32H22N4/c1-3-9-23(10-4-1)24-15-17-25(18-16-24)29-22-30(36-32(35-29)26-11-5-2-6-12-26)27-13-7-14-28(21-27)31-33-19-8-20-34-31/h1-22H |
| InChIKey | OJWHGCZCMWLGRR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |