C31H21N5 — CID 130184133
2,4-diphenyl-6-[3-(4-pyrimidin-2-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 130184133) has the molecular formula C31H21N5 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(4-pyrimidin-2-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-(4-pyrimidin-2-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130184133 |
| Molecular Formula | C31H21N5 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2,4-diphenyl-6-[3-(4-pyrimidin-2-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc(-c5ncccn5)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C31H21N5/c1-3-9-23(10-4-1)29-34-30(24-11-5-2-6-12-24)36-31(35-29)27-14-7-13-26(21-27)22-15-17-25(18-16-22)28-32-19-8-20-33-28/h1-21H |
| InChIKey | QTUDFQFQTCFPKU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |