C21H21P — CID 126680633
[4-[3-(3,5-dimethylphenyl)phenyl]phenyl]methylphosphane (PubChem CID 126680633) has the molecular formula C21H21P and a molecular weight of 304.37 g/mol. Its IUPAC name is [4-[3-(3,5-dimethylphenyl)phenyl]phenyl]methylphosphane.
| Compound Name | [4-[3-(3,5-dimethylphenyl)phenyl]phenyl]methylphosphane |
|---|---|
| PubChem CID | 126680633 |
| Molecular Formula | C21H21P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [4-[3-(3,5-dimethylphenyl)phenyl]phenyl]methylphosphane |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3ccc(CP)cc3)c2)c1 |
| InChI | InChI=1S/C21H21P/c1-15-10-16(2)12-21(11-15)20-5-3-4-19(13-20)18-8-6-17(14-22)7-9-18/h3-13H,14,22H2,1-2H3 |
| InChIKey | IGKGDGTYWPSJOP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|