C16H19P — CID 143253756
3-[4-(3-methylphenyl)phenyl]propylphosphane (PubChem CID 143253756) has the molecular formula C16H19P and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-[4-(3-methylphenyl)phenyl]propylphosphane.
| Compound Name | 3-[4-(3-methylphenyl)phenyl]propylphosphane |
|---|---|
| PubChem CID | 143253756 |
| Molecular Formula | C16H19P |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[4-(3-methylphenyl)phenyl]propylphosphane |
| SMILES | Cc1cccc(-c2ccc(CCCP)cc2)c1 |
| InChI | InChI=1S/C16H19P/c1-13-4-2-6-16(12-13)15-9-7-14(8-10-15)5-3-11-17/h2,4,6-10,12H,3,5,11,17H2,1H3 |
| InChIKey | MWUZCHQWCPCAHE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|