C48H50 — CID 144502837
1,3-dimethyl-5-[4-[7-[4-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]heptyl]phenyl]-2-(3-methylphenyl)benzene (PubChem CID 144502837) has the molecular formula C48H50 and a molecular weight of 626.93 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-[7-[4-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]heptyl]phenyl]-2-(3-methylphenyl)benzene.
| Compound Name | 1,3-dimethyl-5-[4-[7-[4-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]heptyl]phenyl]-2-(3-methylphenyl)benzene |
|---|---|
| PubChem CID | 144502837 |
| Molecular Formula | C48H50 |
| Molecular Weight | 626.93 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | 1,3-dimethyl-5-[4-[7-[4-[3-methyl-4-(3-methylphenyl)phenyl]phenyl]heptyl]phenyl]-2-(3-methylphenyl)benzene |
| SMILES | Cc1cccc(-c2ccc(-c3ccc(CCCCCCCc4ccc(-c5cc(C)c(-c6cccc(C)c6)c(C)c5)cc4)cc3)cc2C)c1 |
| InChI | InChI=1S/C48H50/c1-34-13-11-17-44(29-34)47-28-27-43(31-36(47)3)41-23-19-39(20-24-41)15-9-7-6-8-10-16-40-21-25-42(26-22-40)46-32-37(4)48(38(5)33-46)45-18-12-14-35(2)30-45/h11-14,17-33H,6-10,15-16H2,1-5H3 |
| InChIKey | GRJYNKHKLFQPFR-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.93 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|