About ethane;1-methyl-3-phenylbenzene
ethane;1-methyl-3-phenylbenzene (PubChem CID 142040878) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is ethane;1-methyl-3-phenylbenzene.
Molecular Properties
| Compound Name | ethane;1-methyl-3-phenylbenzene |
| PubChem CID | 142040878 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethane;1-methyl-3-phenylbenzene |
| SMILES | CC.CC.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12.2C2H6/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;2*1-2/h2-10H,1H3;2*1-2H3 |
| InChIKey | JBCLUDXHYMGSRU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-methyl-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-phenylbenzene?
The IUPAC name of ethane;1-methyl-3-phenylbenzene (CID 142040878) is ethane;1-methyl-3-phenylbenzene.
What is the SMILES notation for ethane;1-methyl-3-phenylbenzene?
The canonical SMILES for ethane;1-methyl-3-phenylbenzene is CC.CC.Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of ethane;1-methyl-3-phenylbenzene?
The InChIKey is JBCLUDXHYMGSRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2C2H6/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;2*1-2/h2-10H,1H3;2*1-2H3.
What are the key properties of ethane;1-methyl-3-phenylbenzene?
ethane;1-methyl-3-phenylbenzene has a molecular weight of 228.38 g/mol, XLogP of 5.71, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-phenylbenzene is sourced from PubChem (CID 142040878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).