About ethene;1-methyl-3-phenylbenzene
ethene;1-methyl-3-phenylbenzene (PubChem CID 142622149) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is ethene;1-methyl-3-phenylbenzene.
Molecular Properties
| Compound Name | ethene;1-methyl-3-phenylbenzene |
| PubChem CID | 142622149 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | ethene;1-methyl-3-phenylbenzene |
| SMILES | C=C.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12.C2H4/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-2/h2-10H,1H3;1-2H2 |
| InChIKey | RSBXRVGCSFNJCT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-methyl-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-methyl-3-phenylbenzene?
The IUPAC name of ethene;1-methyl-3-phenylbenzene (CID 142622149) is ethene;1-methyl-3-phenylbenzene.
What is the SMILES notation for ethene;1-methyl-3-phenylbenzene?
The canonical SMILES for ethene;1-methyl-3-phenylbenzene is C=C.Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of ethene;1-methyl-3-phenylbenzene?
The InChIKey is RSBXRVGCSFNJCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C2H4/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-2/h2-10H,1H3;1-2H2.
What are the key properties of ethene;1-methyl-3-phenylbenzene?
ethene;1-methyl-3-phenylbenzene has a molecular weight of 196.29 g/mol, XLogP of 4.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-methyl-3-phenylbenzene is sourced from PubChem (CID 142622149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).