About (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene
(Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene (PubChem CID 145212075) has the molecular formula C26H30
and a molecular weight of 342.53 g/mol. Its IUPAC name is (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene.
Molecular Properties
| Compound Name | (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene |
| PubChem CID | 145212075 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene |
| SMILES | C/C=C\C.C=CC.Cc1cccc(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C19H16.C4H8.C3H6/c1-15-6-5-9-19(14-15)18-12-10-17(11-13-18)16-7-3-2-4-8-16;1-3-4-2;1-3-2/h2-14H,1H3;3-4H,1-2H3;3H,1H2,2H3/b;4-3-; |
| InChIKey | IGWCQSVHGBJNCK-LWFKIUJUSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene?
The IUPAC name of (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene (CID 145212075) is (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene.
What is the SMILES notation for (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene?
The canonical SMILES for (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene is C/C=C\C.C=CC.Cc1cccc(-c2ccc(-c3ccccc3)cc2)c1.
What is the InChIKey of (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene?
The InChIKey is IGWCQSVHGBJNCK-LWFKIUJUSA-N. The full InChI is InChI=1S/C19H16.C4H8.C3H6/c1-15-6-5-9-19(14-15)18-12-10-17(11-13-18)16-7-3-2-4-8-16;1-3-4-2;1-3-2/h2-14H,1H3;3-4H,1-2H3;3H,1H2,2H3/b;4-3-;.
What are the key properties of (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene?
(Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene has a molecular weight of 342.53 g/mol, XLogP of 8.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;1-methyl-3-(4-phenylphenyl)benzene;prop-1-ene is sourced from PubChem (CID 145212075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).