About methanamine;1-methyl-3-phenylbenzene
methanamine;1-methyl-3-phenylbenzene (PubChem CID 145414985) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is methanamine;1-methyl-3-phenylbenzene.
Molecular Properties
| Compound Name | methanamine;1-methyl-3-phenylbenzene |
| PubChem CID | 145414985 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | methanamine;1-methyl-3-phenylbenzene |
| SMILES | CN.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12.CH5N/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-2/h2-10H,1H3;2H2,1H3 |
| InChIKey | ZVRXAJBOEXNFLR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methanamine;1-methyl-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-methyl-3-phenylbenzene?
The IUPAC name of methanamine;1-methyl-3-phenylbenzene (CID 145414985) is methanamine;1-methyl-3-phenylbenzene.
What is the SMILES notation for methanamine;1-methyl-3-phenylbenzene?
The canonical SMILES for methanamine;1-methyl-3-phenylbenzene is CN.Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of methanamine;1-methyl-3-phenylbenzene?
The InChIKey is ZVRXAJBOEXNFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.CH5N/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-2/h2-10H,1H3;2H2,1H3.
What are the key properties of methanamine;1-methyl-3-phenylbenzene?
methanamine;1-methyl-3-phenylbenzene has a molecular weight of 199.30 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-methyl-3-phenylbenzene is sourced from PubChem (CID 145414985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).