C21H22P2 — CID 135225292
[4-[3-methyl-5-[4-(phosphanylmethyl)phenyl]phenyl]phenyl]methylphosphane (PubChem CID 135225292) has the molecular formula C21H22P2 and a molecular weight of 336.36 g/mol. Its IUPAC name is [4-[3-methyl-5-[4-(phosphanylmethyl)phenyl]phenyl]phenyl]methylphosphane.
| Compound Name | [4-[3-methyl-5-[4-(phosphanylmethyl)phenyl]phenyl]phenyl]methylphosphane |
|---|---|
| PubChem CID | 135225292 |
| Molecular Formula | C21H22P2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [4-[3-methyl-5-[4-(phosphanylmethyl)phenyl]phenyl]phenyl]methylphosphane |
| SMILES | Cc1cc(-c2ccc(CP)cc2)cc(-c2ccc(CP)cc2)c1 |
| InChI | InChI=1S/C21H22P2/c1-15-10-20(18-6-2-16(13-22)3-7-18)12-21(11-15)19-8-4-17(14-23)5-9-19/h2-12H,13-14,22-23H2,1H3 |
| InChIKey | PEODGOPGOCNIMB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|