C22H23OP — CID 134164611
2,6-dimethyl-4-[[4-[4-(phosphanylmethyl)phenyl]phenyl]methyl]phenol (PubChem CID 134164611) has the molecular formula C22H23OP and a molecular weight of 334.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-[[4-[4-(phosphanylmethyl)phenyl]phenyl]methyl]phenol.
| Compound Name | 2,6-dimethyl-4-[[4-[4-(phosphanylmethyl)phenyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 134164611 |
| Molecular Formula | C22H23OP |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2,6-dimethyl-4-[[4-[4-(phosphanylmethyl)phenyl]phenyl]methyl]phenol |
| SMILES | Cc1cc(Cc2ccc(-c3ccc(CP)cc3)cc2)cc(C)c1O |
| InChI | InChI=1S/C22H23OP/c1-15-11-19(12-16(2)22(15)23)13-17-3-7-20(8-4-17)21-9-5-18(14-24)6-10-21/h3-12,23H,13-14,24H2,1-2H3 |
| InChIKey | UAHDLGMWPXGDEI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|