C26H24N2 — CID 144764080
5-[[4-[4-(4-methylphenyl)phenyl]phenyl]methyl]benzene-1,3-diamine (PubChem CID 144764080) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-[[4-[4-(4-methylphenyl)phenyl]phenyl]methyl]benzene-1,3-diamine.
| Compound Name | 5-[[4-[4-(4-methylphenyl)phenyl]phenyl]methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 144764080 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 5-[[4-[4-(4-methylphenyl)phenyl]phenyl]methyl]benzene-1,3-diamine |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(Cc4cc(N)cc(N)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2/c1-18-2-6-21(7-3-18)23-10-12-24(13-11-23)22-8-4-19(5-9-22)14-20-15-25(27)17-26(28)16-20/h2-13,15-17H,14,27-28H2,1H3 |
| InChIKey | PRSKZVUZAIJMFG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|